* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(OXOLANE-3-CARBONYL)-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE |
| English Synonyms: | 8-(OXOLANE-3-CARBONYL)-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE |
| MDL Number.: | MFCD17128205 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | C1COCC1C(=O)N2CCC3(CC2)C(=O)NC(=O)N3 |
| InChi: | InChI=1S/C12H17N3O4/c16-9(8-1-6-19-7-8)15-4-2-12(3-5-15)10(17)13-11(18)14-12/h8H,1-7H2,(H2,13,14,17,18) |
| InChiKey: | InChIKey=FHPHYPWBYMYVIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.