Molecular Structure:
CCD No.:CCD03394444
SELENA SEL10734352
Formula:C9 H13 N3 O3 S2
MolWeight:275.352
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10734352 |
| English Synonyms： | SELENA SEL10734352 |
| MDL Number.： | MFCD17128429 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CC1(CCS(=O)(=O)C1)NC(=O)c2csc(n2)N |
| InChi： | InChI=1S/C9H13N3O3S2/c1-9(2-3-17(14,15)5-9)12-7(13)6-4-16-8(10)11-6/h4H,2-3,5H2,1H3,(H2,10,11)(H,12,13) |
| InChiKey： | InChIKey=CUQMIHWFTJHGAB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
