Molecular Structure:
CCD No.:CCD03394623
SELENA SEL10734541
Formula:C9 H9 F3 N2 O3
MolWeight:250.175
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10734541 |
| English Synonyms： | SELENA SEL10734541 |
| MDL Number.： | MFCD17128613 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1cc(=O)n(cc1N)CC(=O)OCC(F)(F)F |
| InChi： | InChI=1S/C9H9F3N2O3/c10-9(11,12)5-17-8(16)4-14-3-6(13)1-2-7(14)15/h1-3H,4-5,13H2 |
| InChiKey： | InChIKey=MMEDUYWHGJVCNI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
