* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10734543 |
English Synonyms: | SELENA SEL10734543 |
MDL Number.: | MFCD17128615 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | c1cc(=O)n(cc1N)CC(=O)OCC(=O)NCC#N |
InChi: | InChI=1S/C11H12N4O4/c12-3-4-14-9(16)7-19-11(18)6-15-5-8(13)1-2-10(15)17/h1-2,5H,4,6-7,13H2,(H,14,16) |
InChiKey: | InChIKey=DTPZRUUQNVKVHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.