Molecular Structure:
CCD No.:CCD03394637
SELENA SEL10734555
Formula:C12 H11 F3 N2
MolWeight:240.227
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10734555 |
| English Synonyms： | SELENA SEL10734555 |
| MDL Number.： | MFCD17128627 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | Cn1cccc1CNc2cc(c(cc2F)F)F |
| InChi： | InChI=1S/C12H11F3N2/c1-17-4-2-3-8(17)7-16-12-6-10(14)9(13)5-11(12)15/h2-6,16H,7H2,1H3 |
| InChiKey： | InChIKey=MVRDIWVUFDTTOH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
