Molecular Structure:
CCD No.:CCD03394693
SELENA SEL10734613
Formula:C10 H10 F3 N O3 S
MolWeight:281.253
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10734613 |
| English Synonyms： | SELENA SEL10734613 |
| MDL Number.： | MFCD17128685 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1c(c(cc(c1F)F)F)NC2CS(=O)(=O)CC2O |
| InChi： | InChI=1S/C10H10F3NO3S/c11-5-1-7(13)8(2-6(5)12)14-9-3-18(16,17)4-10(9)15/h1-2,9-10,14-15H,3-4H2 |
| InChiKey： | InChIKey=GEGCBDMBBLADNE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
