Molecular Structure:
CCD No.:CCD03394976
SELENA SEL10734908
Formula:C11 H12 F3 N O S
MolWeight:263.282
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10734908 |
| English Synonyms： | SELENA SEL10734908 |
| MDL Number.： | MFCD17128980 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1c(cc(c(c1F)F)F)NC2CCS(=O)CC2 |
| InChi： | InChI=1S/C11H12F3NOS/c12-9-5-8(6-10(13)11(9)14)15-7-1-3-17(16)4-2-7/h5-7,15H,1-4H2 |
| InChiKey： | InChIKey=AEAWQXVVVHIVNY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
