Molecular Structure:
CCD No.:CCD03395196
SELENA SEL10735124
Formula:C10 H5 F3 N2 O3
MolWeight:258.155
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735124 |
| English Synonyms： | SELENA SEL10735124 |
| MDL Number.： | MFCD17129202 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1c(cc(c(c1n2cc(c(n2)C(=O)O)O)F)F)F |
| InChi： | InChI=1S/C10H5F3N2O3/c11-4-1-5(12)8(13)6(2-4)15-3-7(16)9(14-15)10(17)18/h1-3,16H,(H,17,18) |
| InChiKey： | InChIKey=GMVBVPIMQJQEOJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
