Molecular Structure:
CCD No.:CCD03395222
SELENA SEL10735154
Formula:C14 H14 F3 N S
MolWeight:285.332
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735154 |
| English Synonyms： | SELENA SEL10735154 |
| MDL Number.： | MFCD17129232 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | CCNC(C)c1ccc(s1)c2cc(c(c(c2)F)F)F |
| InChi： | InChI=1S/C14H14F3NS/c1-3-18-8(2)12-4-5-13(19-12)9-6-10(15)14(17)11(16)7-9/h4-8,18H,3H2,1-2H3 |
| InChiKey： | InChIKey=YWDBYIDYROSWKH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
