Molecular Structure:
CCD No.:CCD03395239
SELENA SEL10735175
Formula:C15 H18 F N O
MolWeight:247.311
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735175 |
| English Synonyms： | SELENA SEL10735175 |
| MDL Number.： | MFCD17129253 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCNCc1ccc(o1)c2ccc(c(c2)C)F |
| InChi： | InChI=1S/C15H18FNO/c1-3-8-17-10-13-5-7-15(18-13)12-4-6-14(16)11(2)9-12/h4-7,9,17H,3,8,10H2,1-2H3 |
| InChiKey： | InChIKey=LVZBHIYISXFCON-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
