Molecular Structure:
CCD No.:CCD03395241
SELENA SEL10735177
Formula:C16 H20 F N O
MolWeight:261.338
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735177 |
| English Synonyms： | SELENA SEL10735177 |
| MDL Number.： | MFCD17129255 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCNC(C)c1ccc(o1)c2ccc(c(c2)C)F |
| InChi： | InChI=1S/C16H20FNO/c1-4-9-18-12(3)15-7-8-16(19-15)13-5-6-14(17)11(2)10-13/h5-8,10,12,18H,4,9H2,1-3H3 |
| InChiKey： | InChIKey=PSNFCYLCSGUSKU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
