Molecular Structure:
CCD No.:CCD03395282
SELENA SEL10735218
Formula:C13 H10 F3 N O2
MolWeight:269.221
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735218 |
| English Synonyms： | SELENA SEL10735218 |
| MDL Number.： | MFCD17129296 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCn1c(ccc1C(=O)O)c2cc(c(c(c2)F)F)F |
| InChi： | InChI=1S/C13H10F3NO2/c1-2-17-10(3-4-11(17)13(18)19)7-5-8(14)12(16)9(15)6-7/h3-6H,2H2,1H3,(H,18,19) |
| InChiKey： | InChIKey=POCIGZWXEIYTAV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
