* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXOLAN-3-YLMETHYL 2-(1,4-DIAZEPAN-1-YL)ACETATE |
| English Synonyms: | OXOLAN-3-YLMETHYL 2-(1,4-DIAZEPAN-1-YL)ACETATE |
| MDL Number.: | MFCD17129573 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C1CNCCN(C1)CC(=O)OCC2CCOC2 |
| InChi: | InChI=1S/C12H22N2O3/c15-12(17-10-11-2-7-16-9-11)8-14-5-1-3-13-4-6-14/h11,13H,1-10H2 |
| InChiKey: | InChIKey=YUQMSOVMVOXOHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.