Molecular Structure:
CCD No.:CCD03395545
SELENA SEL10735501
Formula:C12 H23 N5
MolWeight:237.349
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735501 |
| English Synonyms： | SELENA SEL10735501 |
| MDL Number.： | MFCD17129575 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCCn1c(nnc1CN2CCCNCC2)C |
| InChi： | InChI=1S/C12H23N5/c1-3-7-17-11(2)14-15-12(17)10-16-8-4-5-13-6-9-16/h13H,3-10H2,1-2H3 |
| InChiKey： | InChIKey=CFHWNTVFQVGMTD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
