Molecular Structure:
CCD No.:CCD03395578
OTAVA-BB 4224661
Formula:C14 H19 F N2 O2
MolWeight:266.314
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 4224661 |
| English Synonyms： | OTAVA-BB 4224661 |
| MDL Number.： | MFCD17129612 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1ccc(c(c1)CN2CCCN(CC2)CC(=O)O)F |
| InChi： | InChI=1S/C14H19FN2O2/c15-13-5-2-1-4-12(13)10-16-6-3-7-17(9-8-16)11-14(18)19/h1-2,4-5H,3,6-11H2,(H,18,19) |
| InChiKey： | InChIKey=NYVQIWFTXOKTQM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
