Molecular Structure:
CCD No.:CCD03395645
SELENA SEL10735607
Formula:C12 H14 F N5 O
MolWeight:263.275
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735607 |
| English Synonyms： | SELENA SEL10735607 |
| MDL Number.： | MFCD17129681 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1F)c2nnnn2CC3CCOC3)N |
| InChi： | InChI=1S/C12H14FN5O/c13-9-1-2-11(14)10(5-9)12-15-16-17-18(12)6-8-3-4-19-7-8/h1-2,5,8H,3-4,6-7,14H2 |
| InChiKey： | InChIKey=JHMWGPQHWBTFRV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
