Molecular Structure:
CCD No.:CCD03395704
SELENA SEL10735666
Formula:C13 H17 N O5
MolWeight:267.279
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735666 |
| English Synonyms： | SELENA SEL10735666 |
| MDL Number.： | MFCD17129740 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | CCN(C(=O)c1ccc(cc1O)O)C(C)(C)C(=O)O |
| InChi： | InChI=1S/C13H17NO5/c1-4-14(13(2,3)12(18)19)11(17)9-6-5-8(15)7-10(9)16/h5-7,15-16H,4H2,1-3H3,(H,18,19) |
| InChiKey： | InChIKey=YBWIVKDXSXMBJQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
