* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10735721 |
| English Synonyms: | SELENA SEL10735721 |
| MDL Number.: | MFCD17129795 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCN(C(=O)CCc1nc(no1)C)C(C)(C)C(=O)O |
| InChi: | InChI=1S/C12H19N3O4/c1-5-15(12(3,4)11(17)18)10(16)7-6-9-13-8(2)14-19-9/h5-7H2,1-4H3,(H,17,18) |
| InChiKey: | InChIKey=SWYUDCCSDOALMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.