Molecular Structure:
CCD No.:CCD03395772
SELENA SEL10735734
Formula:C12 H15 F2 N3
MolWeight:239.268
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735734 |
| English Synonyms： | SELENA SEL10735734 |
| MDL Number.： | MFCD17129808 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CCNC(C)(C)c1[nH]c2cc(c(cc2n1)F)F |
| InChi： | InChI=1S/C12H15F2N3/c1-4-15-12(2,3)11-16-9-5-7(13)8(14)6-10(9)17-11/h5-6,15H,4H2,1-3H3,(H,16,17) |
| InChiKey： | InChIKey=HCRDHOUIEXGCAZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
