Molecular Structure:
CCD No.:CCD03395773
SELENA SEL10735735
Formula:C16 H25 N3
MolWeight:259.395
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735735 |
| English Synonyms： | SELENA SEL10735735 |
| MDL Number.： | MFCD17129809 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCCn1c2ccc(cc2nc1C(C)(C)NCC)C |
| InChi： | InChI=1S/C16H25N3/c1-6-10-19-14-9-8-12(3)11-13(14)18-15(19)16(4,5)17-7-2/h8-9,11,17H,6-7,10H2,1-5H3 |
| InChiKey： | InChIKey=NQEJEJIIIRNORL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
