Molecular Structure:
CCD No.:CCD03395776
SELENA SEL10735738
Formula:C14 H20 F N3
MolWeight:249.331
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735738 |
| English Synonyms： | SELENA SEL10735738 |
| MDL Number.： | MFCD17129812 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC(C)n1c2ccc(cc2nc1C(C)(C)NC)F |
| InChi： | InChI=1S/C14H20FN3/c1-9(2)18-12-7-6-10(15)8-11(12)17-13(18)14(3,4)16-5/h6-9,16H,1-5H3 |
| InChiKey： | InChIKey=AWXJTWULGCMAMG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
