Molecular Structure:
CCD No.:CCD03395982
SELENA SEL10735944
Formula:C9 H12 Br N O4 S2
MolWeight:342.233
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10735944 |
| English Synonyms： | SELENA SEL10735944 |
| MDL Number.： | MFCD17130018 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(C)(C(=O)O)N(C)S(=O)(=O)c1c(ccs1)Br |
| InChi： | InChI=1S/C9H12BrNO4S2/c1-9(2,8(12)13)11(3)17(14,15)7-6(10)4-5-16-7/h4-5H,1-3H3,(H,12,13) |
| InChiKey： | InChIKey=ACYUFARUWDCVMQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
