Molecular Structure:
CCD No.:CCD03396236
SELENA SEL10736206
Formula:C12 H20 N4 O3
MolWeight:268.315
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10736206 |
| English Synonyms： | SELENA SEL10736206 |
| MDL Number.： | MFCD17130280 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | CC(Cn1cccn1)NC(=O)N(C)C(C)(C)C(=O)O |
| InChi： | InChI=1S/C12H20N4O3/c1-9(8-16-7-5-6-13-16)14-11(19)15(4)12(2,3)10(17)18/h5-7,9H,8H2,1-4H3,(H,14,19)(H,17,18) |
| InChiKey： | InChIKey=AMQSJUFALRJBPS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
