Molecular Structure:
CCD No.:CCD03396519
SELENA SEL10736495
Formula:C14 H20 N2 O3
MolWeight:264.323
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10736495 |
| English Synonyms： | SELENA SEL10736495 |
| MDL Number.： | MFCD17130569 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCN(C(C)CC(=O)O)C(=O)c1ccc(c(c1)N)C |
| InChi： | InChI=1S/C14H20N2O3/c1-4-16(10(3)7-13(17)18)14(19)11-6-5-9(2)12(15)8-11/h5-6,8,10H,4,7,15H2,1-3H3,(H,17,18) |
| InChiKey： | InChIKey=MXZXYKDPJACIPV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
