Molecular Structure:
CCD No.:CCD03396574
SELENA SEL10736554
Formula:C11 H18 N4 O3
MolWeight:254.288
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10736554 |
| English Synonyms： | SELENA SEL10736554 |
| MDL Number.： | MFCD17130628 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | CCN(C(C)CC(=O)O)C(=O)Nc1ccn(n1)C |
| InChi： | InChI=1S/C11H18N4O3/c1-4-15(8(2)7-10(16)17)11(18)12-9-5-6-14(3)13-9/h5-6,8H,4,7H2,1-3H3,(H,16,17)(H,12,13,18) |
| InChiKey： | InChIKey=UDUIRWIXGCDODI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
