Molecular Structure:
CCD No.:CCD03396582
SELENA SEL10736562
Formula:C12 H18 N4 S
MolWeight:250.368
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10736562 |
| English Synonyms： | SELENA SEL10736562 |
| MDL Number.： | MFCD17130636 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCNC(C)Cc1nc(nn1C)c2cccs2 |
| InChi： | InChI=1S/C12H18N4S/c1-4-13-9(2)8-11-14-12(15-16(11)3)10-6-5-7-17-10/h5-7,9,13H,4,8H2,1-3H3 |
| InChiKey： | InChIKey=MTGMCRCMTBOUJK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
