Molecular Structure:
CCD No.:CCD03397011
SELENA SEL10736998
Formula:C12 H24 N2 O4 S
MolWeight:292.398
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10736998 |
| English Synonyms： | SELENA SEL10736998 |
| MDL Number.： | MFCD17131072 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CCNCC(C)C(=O)N(CCO)C1CCS(=O)(=O)C1 |
| InChi： | InChI=1S/C12H24N2O4S/c1-3-13-8-10(2)12(16)14(5-6-15)11-4-7-19(17,18)9-11/h10-11,13,15H,3-9H2,1-2H3 |
| InChiKey： | InChIKey=REVWRCXORUOKBI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
