Molecular Structure:
CCD No.:CCD03397080
SELENA SEL10737067
Formula:C11 H18 N4 O3
MolWeight:254.288
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10737067 |
| English Synonyms： | SELENA SEL10737067 |
| MDL Number.： | MFCD17131141 |
| H bond acceptor： | 7 |
| H bond donor： | 3 |
| Smile： | CCNCC(C)C(=O)Nc1cnn(c1)CC(=O)O |
| InChi： | InChI=1S/C11H18N4O3/c1-3-12-4-8(2)11(18)14-9-5-13-15(6-9)7-10(16)17/h5-6,8,12H,3-4,7H2,1-2H3,(H,14,18)(H,16,17) |
| InChiKey： | InChIKey=ZNICBYRXHMCSQO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
