* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10737338 |
English Synonyms: | SELENA SEL10737338 |
MDL Number.: | MFCD17131412 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CCNC(C)CC(=O)N[C@@H](CCC(=O)O)C(=O)O |
InChi: | InChI=1S/C11H20N2O5/c1-3-12-7(2)6-9(14)13-8(11(17)18)4-5-10(15)16/h7-8,12H,3-6H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t7?,8-/m0/s1 |
InChiKey: | InChIKey=CLXYVJXNWSZTPD-MQWKRIRWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.