Molecular Structure:
CCD No.:CCD03397523
SELENA SEL10737513
Formula:C13 H17 N5
MolWeight:243.312
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10737513 |
| English Synonyms： | SELENA SEL10737513 |
| MDL Number.： | MFCD17131587 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1cn(cn1)CCCNc2c3c(ncn2)CCC3 |
| InChi： | InChI=1S/C13H17N5/c1-3-11-12(4-1)16-9-17-13(11)15-5-2-7-18-8-6-14-10-18/h6,8-10H,1-5,7H2,(H,15,16,17) |
| InChiKey： | InChIKey=LBWGSODEDOVBGC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
