Molecular Structure:
CCD No.:CCD03398569
SELENA SEL10738579
Formula:C15 H26 N2 S
MolWeight:266.45
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10738579 |
| English Synonyms： | SELENA SEL10738579 |
| MDL Number.： | MFCD17132651 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCN(CC)CCCNC1CCCc2c1ccs2 |
| InChi： | InChI=1S/C15H26N2S/c1-3-17(4-2)11-6-10-16-14-7-5-8-15-13(14)9-12-18-15/h9,12,14,16H,3-8,10-11H2,1-2H3 |
| InChiKey： | InChIKey=HIGVMUCMLSUWGM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
