Molecular Structure:
CCD No.:CCD03398586
SELENA SEL10738596
Formula:C16 H28 N2 S
MolWeight:280.477
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10738596 |
| English Synonyms： | SELENA SEL10738596 |
| MDL Number.： | MFCD17132668 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CC(C)CC(CNC1CCCc2c1ccs2)N(C)C |
| InChi： | InChI=1S/C16H28N2S/c1-12(2)10-13(18(3)4)11-17-15-6-5-7-16-14(15)8-9-19-16/h8-9,12-13,15,17H,5-7,10-11H2,1-4H3 |
| InChiKey： | InChIKey=MXQPYEOIBIPMKQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
