Molecular Structure:
CCD No.:CCD03398601
SELENA SEL10738611
Formula:C13 H16 O3 S
MolWeight:252.332
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10738611 |
| English Synonyms： | SELENA SEL10738611 |
| MDL Number.： | MFCD17132683 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | CCOCCC(=O)C1CCc2c(ccs2)C1=O |
| InChi： | InChI=1S/C13H16O3S/c1-2-16-7-5-11(14)9-3-4-12-10(13(9)15)6-8-17-12/h6,8-9H,2-5,7H2,1H3 |
| InChiKey： | InChIKey=RSEGNDCJOSVTIW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
