Molecular Structure:
CCD No.:CCD03398618
SELENA SEL10738629
Formula:C14 H17 N3 S
MolWeight:259.375
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10738629 |
| English Synonyms： | SELENA SEL10738629 |
| MDL Number.： | MFCD17132701 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | c1csc2c1-c3c(nc([nH]3)CC4CCCN4)CC2 |
| InChi： | InChI=1S/C14H17N3S/c1-2-9(15-6-1)8-13-16-11-3-4-12-10(5-7-18-12)14(11)17-13/h5,7,9,15H,1-4,6,8H2,(H,16,17) |
| InChiKey： | InChIKey=QZBRGDXXUYOIIZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
