Molecular Structure:
CCD No.:CCD03398663
SELENA SEL10738674
Formula:C15 H13 F N2 S
MolWeight:272.346
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10738674 |
| English Synonyms： | SELENA SEL10738674 |
| MDL Number.： | MFCD17132746 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc(c(c1)NC2(CCCc3c2ccs3)C#N)F |
| InChi： | InChI=1S/C15H13FN2S/c16-12-4-1-2-5-13(12)18-15(10-17)8-3-6-14-11(15)7-9-19-14/h1-2,4-5,7,9,18H,3,6,8H2 |
| InChiKey： | InChIKey=YYDOPYUWYAUYLH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
