* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10738842 |
English Synonyms: | SELENA SEL10738842 |
MDL Number.: | MFCD17132914 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(c1ccsc1)NCC(COC(C)(C)C)O |
InChi: | InChI=1S/C13H23NO2S/c1-10(11-5-6-17-9-11)14-7-12(15)8-16-13(2,3)4/h5-6,9-10,12,14-15H,7-8H2,1-4H3 |
InChiKey: | InChIKey=CDWQXGBSDCNFID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.