Molecular Structure:
CCD No.:CCD03399013
SELENA SEL10739034
Formula:C14 H14 N2 O S2
MolWeight:290.41
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739034 |
| English Synonyms： | SELENA SEL10739034 |
| MDL Number.： | MFCD17133106 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CC(c1ccsc1)NC(=O)c2ccc(s2)C#CCN |
| InChi： | InChI=1S/C14H14N2OS2/c1-10(11-6-8-18-9-11)16-14(17)13-5-4-12(19-13)3-2-7-15/h4-6,8-10H,7,15H2,1H3,(H,16,17) |
| InChiKey： | InChIKey=WIRKUPOYYLFZJS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
