Molecular Structure:
CCD No.:CCD03399098
SELENA SEL10739129
Formula:C14 H24 N2 O S
MolWeight:268.423
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739129 |
| English Synonyms： | SELENA SEL10739129 |
| MDL Number.： | MFCD17133201 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CN(CCNC1CCCc2c1ccs2)CCOC |
| InChi： | InChI=1S/C14H24N2OS/c1-16(9-10-17-2)8-7-15-13-4-3-5-14-12(13)6-11-18-14/h6,11,13,15H,3-5,7-10H2,1-2H3 |
| InChiKey： | InChIKey=CJBHHTKHIKXFDK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
