Molecular Structure:
CCD No.:CCD03399173
SELENA SEL10739206
Formula:C12 H17 N3 O2 S2
MolWeight:299.417
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739206 |
| English Synonyms： | SELENA SEL10739206 |
| MDL Number.： | MFCD17133278 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CN(CCn1c(=O)c2c(ccs2)nc1S)CCOC |
| InChi： | InChI=1S/C12H17N3O2S2/c1-14(6-7-17-2)4-5-15-11(16)10-9(3-8-19-10)13-12(15)18/h3,8H,4-7H2,1-2H3,(H,13,18) |
| InChiKey： | InChIKey=WNDFSWLENDKLHN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
