Molecular Structure:
CCD No.:CCD03399289
SELENA SEL10739328
Formula:C14 H13 F N2 O2
MolWeight:260.267
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739328 |
| English Synonyms： | SELENA SEL10739328 |
| MDL Number.： | MFCD17133400 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1cc(=O)n(nc1)CCCC(=O)c2ccc(cc2)F |
| InChi： | InChI=1S/C14H13FN2O2/c15-12-7-5-11(6-8-12)13(18)3-2-10-17-14(19)4-1-9-16-17/h1,4-9H,2-3,10H2 |
| InChiKey： | InChIKey=ICCIXJFCRQPTJA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
