Molecular Structure:
CCD No.:CCD03399382
SELENA SEL10739439
Formula:C14 H22 N4 S
MolWeight:278.422
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739439 |
| English Synonyms： | SELENA SEL10739439 |
| MDL Number.： | MFCD17133511 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)CCNCCSc1nnc2n1cccc2 |
| InChi： | InChI=1S/C14H22N4S/c1-14(2,3)7-8-15-9-11-19-13-17-16-12-6-4-5-10-18(12)13/h4-6,10,15H,7-9,11H2,1-3H3 |
| InChiKey： | InChIKey=CSNOVERWQXVVJS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
