Molecular Structure:
CCD No.:CCD03399384
SELENA SEL10739441
Formula:C12 H18 N4 O S
MolWeight:266.367
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739441 |
| English Synonyms： | SELENA SEL10739441 |
| MDL Number.： | MFCD17133513 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(CNCCOC)Sc1nnc2n1cccc2 |
| InChi： | InChI=1S/C12H18N4OS/c1-10(9-13-6-8-17-2)18-12-15-14-11-5-3-4-7-16(11)12/h3-5,7,10,13H,6,8-9H2,1-2H3 |
| InChiKey： | InChIKey=DDRKXYXUXGKENS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
