Molecular Structure:
CCD No.:CCD03399385
SELENA SEL10739442
Formula:C12 H18 N4 S
MolWeight:250.368
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739442 |
| English Synonyms： | SELENA SEL10739442 |
| MDL Number.： | MFCD17133514 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCCNCC(C)Sc1nnc2n1cccc2 |
| InChi： | InChI=1S/C12H18N4S/c1-3-7-13-9-10(2)17-12-15-14-11-6-4-5-8-16(11)12/h4-6,8,10,13H,3,7,9H2,1-2H3 |
| InChiKey： | InChIKey=LRPBKFXHUDXADQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
