Molecular Structure:
CCD No.:CCD03399391
SELENA SEL10739452
Formula:C12 H15 N3 O2 S
MolWeight:265.336
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739452 |
| English Synonyms： | SELENA SEL10739452 |
| MDL Number.： | MFCD17133520 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1cc(sc1)CN2C(=O)C3(CCNCC3)NC2=O |
| InChi： | InChI=1S/C12H15N3O2S/c16-10-12(3-5-13-6-4-12)14-11(17)15(10)8-9-2-1-7-18-9/h1-2,7,13H,3-6,8H2,(H,14,17) |
| InChiKey： | InChIKey=ZEDWTIDWYKOYKC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
