* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(2,2-DIMETHYLBUTANOYL)-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE |
| English Synonyms: | 8-(2,2-DIMETHYLBUTANOYL)-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE |
| MDL Number.: | MFCD17133528 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCC(C)(C)C(=O)N1CCC2(CC1)C(=O)NC(=O)N2 |
| InChi: | InChI=1S/C13H21N3O3/c1-4-12(2,3)10(18)16-7-5-13(6-8-16)9(17)14-11(19)15-13/h4-8H2,1-3H3,(H2,14,15,17,19) |
| InChiKey: | InChIKey=BDEGRCPDKMDSHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.