Molecular Structure:
CCD No.:CCD03399406
SELENA SEL10739467
Formula:C11 H14 Cl N3 O2
MolWeight:255.704
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739467 |
| English Synonyms： | SELENA SEL10739467 |
| MDL Number.： | MFCD17133535 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCn1cc(cc1C(=O)N2CCNC(=O)C2)Cl |
| InChi： | InChI=1S/C11H14ClN3O2/c1-2-14-6-8(12)5-9(14)11(17)15-4-3-13-10(16)7-15/h5-6H,2-4,7H2,1H3,(H,13,16) |
| InChiKey： | InChIKey=WCMNMTZMTPQULE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
