Molecular Structure:
CCD No.:CCD03399434
SELENA SEL10739496
Formula:C12 H15 N3 O2
MolWeight:233.27
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739496 |
| English Synonyms： | SELENA SEL10739496 |
| MDL Number.： | MFCD17133563 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | c1cc(c2c(c1)NCCC2)C(=O)NCC(=O)N |
| InChi： | InChI=1S/C12H15N3O2/c13-11(16)7-15-12(17)9-3-1-5-10-8(9)4-2-6-14-10/h1,3,5,14H,2,4,6-7H2,(H2,13,16)(H,15,17) |
| InChiKey： | InChIKey=OHLVKVZHZOLRCL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
