Molecular Structure:
CCD No.:CCD03399448
SELENA SEL10739510
Formula:C12 H11 N3 O4
MolWeight:261.236
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739510 |
| English Synonyms： | SELENA SEL10739510 |
| MDL Number.： | MFCD17133577 |
| H bond acceptor： | 7 |
| H bond donor： | 3 |
| Smile： | c1cc2c(cc1C(=O)N[C@@H](CO)C(=O)O)nccn2 |
| InChi： | InChI=1S/C12H11N3O4/c16-6-10(12(18)19)15-11(17)7-1-2-8-9(5-7)14-4-3-13-8/h1-5,10,16H,6H2,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChiKey： | InChIKey=USHVRGCZTIUIPA-JTQLQIEISA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
