Molecular Structure:
CCD No.:CCD03399543
SELENA SEL10739692
Formula:C13 H14 N4 O2
MolWeight:258.28
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10739692 |
| English Synonyms： | SELENA SEL10739692 |
| MDL Number.： | MFCD17133752 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CN(C/C(=N/O)/N)C(=O)c1ccc2c(c1)cccn2 |
| InChi： | InChI=1S/C13H14N4O2/c1-17(8-12(14)16-19)13(18)10-4-5-11-9(7-10)3-2-6-15-11/h2-7,19H,8H2,1H3,(H2,14,16) |
| InChiKey： | InChIKey=NAPOSQLQFAXRGU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
