* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10739761 |
| English Synonyms: | SELENA SEL10739761 |
| MDL Number.: | MFCD17133820 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1ccc2c(c1)nc([nH]2)SCCCC(C)(C#N)N |
| InChi: | InChI=1S/C14H18N4S/c1-10-4-5-11-12(8-10)18-13(17-11)19-7-3-6-14(2,16)9-15/h4-5,8H,3,6-7,16H2,1-2H3,(H,17,18) |
| InChiKey: | InChIKey=NJGMKVMFAVOYNA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.